Peptide Synthesis

Shop By
View as List Grid

5 Items

Set Descending Direction
  1. L-O-Phosphoserine(L-SOP), Agonist of mGlu 4 receptor;Agonist of mGlu 6 receptor;Agonist of mGlu 7 receptor;Agonist of mGlu 8 receptor
    Cas#: 407-41-0        Compound CID:  68841
    Formula:  C3H8NO6P        Molecular Weight: 185.07
    IUPAC Name: (2S)-2-amino-3-phosphonooxypropanoic acid
    SMILES: C(C(C(=O)O)N)OP(=O)(O)O
    InChIKey: BZQFBWGGLXLEPQ-REOHCLBHSA-N
    InChI: InChI=1S/C3H8NO6P/c4-2(3(5)6)1-10-11(7,8)9/h2H,1,4H2,(H,5,6)(H2,7,8,9)/t2-/m0/s1
    Synonyms: L-SOP | CAS-407-41-0 | H-Ser(PO3H2)-OH | Phosphatidalserine | A873241 | CCG-204968 | NCGC00261571-01 | s5137 | (2S)-2...
  2. D-Aspartic acid, Excitatory amino acid transporter 1;Excitatory amino acid transporter 2;Excitatory amino acid transporter 3;Excitatory amino acid transporter 4;Excitatory amino acid transporter 5;Agonist of GluN1;Agonist of GluN2A;Agonist of GluN2B;Agonist of GluN2C;Agon
    Cas#: 1783-96-6        Compound CID:  83887
    Formula:  C4H7NO4        Molecular Weight: 133.10
    IUPAC Name: (2R)-2-aminobutanedioic acid
    SMILES: C(C(C(=O)O)N)C(=O)O
    InChIKey: CKLJMWTZIZZHCS-UWTATZPHSA-N
    InChI: InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m1/s1
    Synonyms: 2,2'-methanediylbis(1H-benzimidazole) | 6-benzyloxy-1H-indole | C4H7NO4 | delta-aspartate | SR-01000597731 | C00402 |...
  3. L-Aspartic acid, Agonist of GluN1;Agonist of GluN2A;Agonist of GluN2B;Agonist of GluN2C;Agonist of GluN2D
    Cas#: 56-84-8        Compound CID:  5960
    Formula:  C4H7NO4        Molecular Weight: 133.10
    IUPAC Name: (2S)-2-aminobutanedioic acid
    SMILES: N[C@@H](CC(O)=O)C(O)=O
    InChIKey: CKLJMWTZIZZHCS-REOHCLBHSA-N
    InChI: InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1
    Synonyms: Acide aspartique | Asparaginsaeure | Aspartic acid [USAN:USP:INN] | Aspatofort | EINECS 200-291-6 | [3h]-l-asp | ASPA...
  4. L-Histidine, Peptide transporter 3;Peptide transporter 4;Sodium-coupled neutral amino acid transporter 5
    Cas#: 71-00-1        Compound CID:  6274
    Formula:  C6H9N3O2        Molecular Weight: 155.15
    IUPAC Name: (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid
    SMILES: C1=C(NC=N1)CC(C(=O)O)N
    InChIKey: HNDVDQJCIGZPNO-YFKPBYRVSA-N
    InChI: InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m0/s1
    Synonyms: (S)-2-Amino-3-(4-imidazolyl)propionic acid | NSC 137773 | H-His-OH
  5. β-Alanine
    Cas#: 107-95-9        Compound CID:  239
    Formula:  C3H7NO2        Molecular Weight: 89.09
    IUPAC Name: 3-aminopropanoic acid
    SMILES: C(CN)C(=O)O
    InChIKey: UCMIRNVEIXFBKS-UHFFFAOYSA-N
    InChI: InChI=1S/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6)
    Synonyms: ALANINE, BETA | Alanine, beta- | BETA ALANINE [USP-RS] | EC 203-536-5 | HY-N0230 | omega-Aminopropionate | Q310919 | ...
per page