| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| F115885-250mg | 250mg | 8 | $93.90 | |
| F115885-1g | 1g | 8 | $267.90 | |
| F115885-5g | 5g | 2 | $1,205.90 |
| Synonyms | SCHEMBL119197 | A813671 | (S)-3-(Fmoc-amino)-5-methylhexanoic acid | CS-W011805 | 4-(2-OXO-2,3-DIHYDRO-1H-INDOL-3-YL)BUTANOICACID | Fmoc--HoLeu-OH Fmoc--homoleucine | (3S)-3-({[(9H-FLUOREN-9-YL)METHOXY]CARBONYL}AMINO)-5-METHYLHEXANOIC ACID | MFCD01863059 |
|---|---|
| Specifications & Purity | ≥96% |
| Storage Temp | Store at 2-8°C |
| Shipped In | Wet ice |
| Pubchem Sid | 488193230 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488193230 |
| IUPAC Name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-methylhexanoic acid |
| INCHI | InChI=1S/C22H25NO4/c1-14(2)11-15(12-21(24)25)23-22(26)27-13-20-18-9-5-3-7-16(18)17-8-4-6-10-19(17)20/h3-10,14-15,20H,11-13H2,1-2H3,(H,23,26)(H,24,25)/t15-/m0/s1 |
| InChi Key | YLVSABQQLLRFIJ-HNNXBMFYSA-N |
| Canonical SMILES | CC(C)CC(CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
| Isomeric SMILES | CC(C)C[C@@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
| WGK Germany | 3 |
| PubChem CID | 2761527 |
| Molecular Weight | 367.44 |
| Beilstein | 7723942 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
 D2308967 | Certificate of Analysis | Jan 14, 2023 | F115885 |
| D2308957 | Certificate of Analysis | Jan 14, 2023 | F115885 |
| D23081149 | Certificate of Analysis | Jan 14, 2023 | F115885 |
| D2308966 | Certificate of Analysis | Jan 14, 2023 | F115885 |
| D2308973 | Certificate of Analysis | Jan 14, 2023 | F115885 |
| D2308963 | Certificate of Analysis | Jan 14, 2023 | F115885 |
| J2225126 | Certificate of Analysis | Nov 10, 2022 | F115885 |
| J1819154 | Certificate of Analysis | Aug 10, 2022 | F115885 |
| Sensitivity | Heat Sensitive |
|---|---|
| Specific Rotation[α] | -29° (C=0.15,CHCl3) |
| Melt Point(°C) | 110 °C |
| Molecular Weight | 367.400 g/mol |
| XLogP3 | 4.300 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 8 |
| Exact Mass | 367.178 Da |
| Monoisotopic Mass | 367.178 Da |
| Topological Polar Surface Area | 75.600 Ų |
| Heavy Atom Count | 27 |
| Formal Charge | 0 |
| Complexity | 498.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| WGK Germany | 3 |
|---|
