| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| T162488-100mg | 100mg | 3 | $68.90 | |
| T162488-250mg | 250mg | 2 | $130.90 | |
| T162488-1g | 1g | 1 | $402.90 | |
| T162488-5g | 5g | 1 | $1,812.90 |
| Specifications & Purity | ≥95% |
|---|---|
| Storage Temp | Store at 2-8°C |
| Shipped In | Wet ice |
| Pubchem Sid | 504768071 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504768071 |
| IUPAC Name | 4-[3,5-bis[4-(N-phenylanilino)phenyl]phenyl]-N,N-diphenylaniline |
| INCHI | InChI=1S/C60H45N3/c1-7-19-52(20-8-1)61(53-21-9-2-10-22-53)58-37-31-46(32-38-58)49-43-50(47-33-39-59(40-34-47)62(54-23-11-3-12-24-54)55-25-13-4-14-26-55)45-51(44-49)48-35-41-60(42-36-48)63(56-27-15-5-16-28-56)57-29-17-6-18-30-57/h1-45H |
| InChi Key | XVMUGTFNHXHZIP-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC(=CC(=C4)C5=CC=C(C=C5)N(C6=CC=CC=C6)C7=CC=CC=C7)C8=CC=C(C=C8)N(C9=CC=CC=C9)C1=CC=CC=C1 |
| Isomeric SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC(=CC(=C4)C5=CC=C(C=C5)N(C6=CC=CC=C6)C7=CC=CC=C7)C8=CC=C(C=C8)N(C9=CC=CC=C9)C1=CC=CC=C1 |
| PubChem CID | 16180236 |
| Molecular Weight | 808.04 |
| Reaxy-Rn | 8746598 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
 H2325769 | Certificate of Analysis | Aug 07, 2023 | T162488 |
| H2325778 | Certificate of Analysis | Aug 07, 2023 | T162488 |
| H2325781 | Certificate of Analysis | Aug 07, 2023 | T162488 |
| H2325790 | Certificate of Analysis | Aug 07, 2023 | T162488 |
| H2325782 | Certificate of Analysis | Aug 07, 2023 | T162488 |
| H2325786 | Certificate of Analysis | Aug 07, 2023 | T162488 |
| H2325784 | Certificate of Analysis | Aug 07, 2023 | T162488 |
| H2325743 | Certificate of Analysis | Aug 07, 2023 | T162488 |
| Molecular Weight | 808.000 g/mol |
|---|---|
| XLogP3 | 16.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 12 |
| Exact Mass | 807.361 Da |
| Monoisotopic Mass | 807.361 Da |
| Topological Polar Surface Area | 9.700 Ų |
| Heavy Atom Count | 63 |
| Formal Charge | 0 |
| Complexity | 1050.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| Reaxy-Rn | 8746598 |
|---|
