| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| D167436-250mg | 250mg | 2 | $75.90 | |
| D167436-1g | 1g | 2 | $130.90 | |
| D167436-5g | 5g | 2 | $391.90 |
| Synonyms | (2,4-Dipropoxyphenyl)boronic acid | 150145-25-8 | 2,4-Dipropoxyphenylboronic acid | Boronic acid, (2,4-dipropoxyphenyl)- (9CI) | C12H19BO4 | (2,4-Dipropoxyphenyl)boronicacid | SCHEMBL3783765 | DTXSID30584904 | MFCD09265142 | AKOS015839549 | 2,4-Dipropoxyphenylboronic acid, > |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C,Argon charged |
| Shipped In | Wet ice |
| Pubchem Sid | 504768337 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504768337 |
| IUPAC Name | (2,4-dipropoxyphenyl)boronic acid |
| INCHI | InChI=1S/C12H19BO4/c1-3-7-16-10-5-6-11(13(14)15)12(9-10)17-8-4-2/h5-6,9,14-15H,3-4,7-8H2,1-2H3 |
| InChi Key | ZNGNDOSZRKWKJW-UHFFFAOYSA-N |
| Canonical SMILES | B(C1=C(C=C(C=C1)OCCC)OCCC)(O)O |
| Isomeric SMILES | B(C1=C(C=C(C=C1)OCCC)OCCC)(O)O |
| WGK Germany | 3 |
| PubChem CID | 16218359 |
| Molecular Weight | 238.09 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
 D2015027 | Certificate of Analysis | Feb 07, 2023 | D167436 |
| Sensitivity | heat sensitive |
|---|---|
| Melt Point(°C) | 121-127 °C |
| Molecular Weight | 238.090 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 7 |
| Exact Mass | 238.138 Da |
| Monoisotopic Mass | 238.138 Da |
| Topological Polar Surface Area | 58.900 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 201.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| WGK Germany | 3 |
|---|
