Determine the necessary mass, volume, or concentration for preparing a solution.
Basic Description
| Synonyms | 3,6-dichloropyridine-2-carboxamide | 1532-25-8 | 3,6-Dichloropicolinamide | 3,6-Dichloro-2-pyridinecarboxamide | 3,6-Dichloro-pyridine-2-carboxylic acid amide | SCHEMBL2212207 | DTXSID60352532 | BAA53225 | MFCD00186645 | STK365543 | AKOS000246753 | PS-5027 | SB52643 | CS-0215001 | F |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Names and Identifiers
| IUPAC Name | 3,6-dichloropyridine-2-carboxamide |
|---|---|
| INCHI | InChI=1S/C6H4Cl2N2O/c7-3-1-2-4(8)10-5(3)6(9)11/h1-2H,(H2,9,11) |
| InChi Key | RFBSMVHKAFPDKD-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=NC(=C1Cl)C(=O)N)Cl |
| Isomeric SMILES | C1=CC(=NC(=C1Cl)C(=O)N)Cl |
| PubChem CID | 728681 |
| Molecular Weight | 191.018 |
Certificates（CoA,COO,BSE/TSE and Analysis Chart)
C of A & Other Certificates(BSE/TSE, COO):
Analytical Chart:
Chemical and Physical Properties
| Molecular Weight | 191.010 g/mol |
|---|---|
| XLogP3 | 1.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 189.97 Da |
| Monoisotopic Mass | 189.97 Da |
| Topological Polar Surface Area | 56.000 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 165.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Safety and Hazards(GHS)
| Pictogram(s) | GHS07 |
|---|---|
| Signal | Warning |
| Hazard Statements | H319:Causes serious eye irritation H302:Harmful if swallowed |
| Precautionary Statements | P305+P351+P338:IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses if present and easy to do - continue rinsing. P280:Wear protective gloves/protective clothing/eye protection/face protection. P501:Dispose of contents/container to ... P264:Wash hands [and …] thoroughly after handling. P270:Do not eat, drink or smoke when using this product. P330:Rinse mouth. P264+P265:Wash hands [and …] thoroughly after handling. Do not touch eyes. P301+P317:IF SWALLOWED: Get medical help. P337+P317:If eye irritation persists: Get medical help. |