The store will not work correctly when cookies are disabled.
4-Fluoro-L-2-phenylglycine - 98%, high purity , CAS No.19883-57-9
Basic Description
| Synonyms | AKOS015854067 | L-4-Fluorophenylglycine | (2S)-2-azaniumyl-2-(4-fluorophenyl)acetate | 2-(4-fluorophenylamino)acetic acid;DL-4-FLUOROPHENYLGLYCINE | A13348 | L4FPG | EN300-91504 | Q-200473 | H-Phg(4-F)-OH | (s)-2-amino-2-(4-fluorophenyl)acetic acid | 4-Fl |
|---|
| Specifications & Purity | ≥98% |
|---|
| Shipped In | Normal |
|---|
Associated Targets(Human)
Associated Targets(non-human)
Mechanisms of Action
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
Names and Identifiers
| Pubchem Sid | 488191621 |
|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488191621 |
|---|
| IUPAC Name | (2S)-2-amino-2-(4-fluorophenyl)acetic acid |
|---|
| INCHI | InChI=1S/C8H8FNO2/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7H,10H2,(H,11,12)/t7-/m0/s1 |
|---|
| InChi Key | JKFYKCYQEWQPTM-ZETCQYMHSA-N |
|---|
| Canonical SMILES | C1=CC(=CC=C1C(C(=O)O)N)F |
|---|
| Isomeric SMILES | C1=CC(=CC=C1[C@@H](C(=O)O)N)F |
|---|
| PubChem CID | 853015 |
|---|
| Molecular Weight | 169.16 |
|---|
| Reaxy-Rn | 5850631 |
|---|
Certificates（CoA,COO,BSE/TSE and Analysis Chart)
Chemical and Physical Properties
| Solubility | Soluble in 1M HCl. |
|---|
| Freezing Point(°C) | +135 to +145 deg(C=1, 1mol/L HCl) |
|---|
| Specific Rotation[α] | 138° (C=1,1mol/L Hcl) |
|---|
| Melt Point(°C) | >300℃ |
|---|
| Molecular Weight | 169.150 g/mol |
|---|
| XLogP3 | -1.600 |
|---|
| Hydrogen Bond Donor Count | 2 |
|---|
| Hydrogen Bond Acceptor Count | 4 |
|---|
| Rotatable Bond Count | 2 |
|---|
| Exact Mass | 169.054 Da |
|---|
| Monoisotopic Mass | 169.054 Da |
|---|
| Topological Polar Surface Area | 63.300 Ų |
|---|
| Heavy Atom Count | 12 |
|---|
| Formal Charge | 0 |
|---|
| Complexity | 166.000 |
|---|
| Isotope Atom Count | 0 |
|---|
| Defined Atom Stereocenter Count | 1 |
|---|
| Undefined Atom Stereocenter Count | 0 |
|---|
| Defined Bond Stereocenter Count | 0 |
|---|
| Undefined Bond Stereocenter Count | 0 |
|---|
| The total count of all stereochemical bonds | 0 |
|---|
| Covalently-Bonded Unit Count | 1 |
|---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator
J2421593