| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| B119385-25g | 25g | 4 | $210.90 |
| Synonyms | BARIUM PERCHLORATE | 13465-95-7 | Barium diperchlorate | Perchloric acid, barium salt | barium(2+);diperchlorate | Perchloric acid, barium salt (2:1) | EY48PA0C98 | BARIUM PERCHLORATE, ANHYDROUS | EINECS 236-710-4 | UNII-EY48PA0C98 | MFCD00003440 | Barium perchlorate, 97% | Perc |
|---|---|
| Specifications & Purity | PrimorTrace™, ≥99.99% metals basis |
| Shipped In | Normal |
| Grade | PrimorTrace™ |
| Pubchem Sid | 504753793 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504753793 |
| IUPAC Name | barium(2+);diperchlorate |
| INCHI | InChI=1S/Ba.2ClHO4/c;2*2-1(3,4)5/h;2*(H,2,3,4,5)/q+2;;/p-2 |
| InChi Key | OOULUYZFLXDWDQ-UHFFFAOYSA-L |
| Canonical SMILES | [O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[Ba+2] |
| Isomeric SMILES | [O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[Ba+2] |
| WGK Germany | 3 |
| RTECS | SC7550000 |
| PubChem CID | 61623 |
| UN Number | 1447(solid)3406(solution) |
| Packing Group | II |
| Molecular Weight | 336.23 |
| Sensitivity | moisture sensitive |
|---|---|
| Flash Point(°F) | 69.8 °F |
| Flash Point(°C) | 21 °C |
| Melt Point(°C) | 505°C |
| Molecular Weight | 336.230 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 0 |
| Exact Mass | 335.802 Da |
| Monoisotopic Mass | 335.802 Da |
| Topological Polar Surface Area | 149.000 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 95.800 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |
| Pictogram(s) | GHS07, GHS03 |
|---|---|
| Signal | Danger |
| Hazard Statements | H302:Harmful if swallowed H332:Harmful if inhaled H271:May cause fire or explosion; strong Oxidizer |
| Precautionary Statements | P261:Avoid breathing dust/fume/gas/mist/vapors/spray. P280:Wear protective gloves/protective clothing/eye protection/face protection. P370+P378:In case of fire: Use ... to extinguish. P210:Keep away from heat, hot surface, sparks, open flames and other ignition sources. - No smoking. P501:Dispose of contents/container to ... P264:Wash hands [and …] thoroughly after handling. P220:Keep away from clothing and other combustible materials. P271:Use only outdoors or in a well-ventilated area. P270:Do not eat, drink or smoke when using this product. P304+P340:IF INHALED: Remove person to fresh air and keep comfortable for breathing. P371+P380+P375:In case of major fire and large quantities: Evacuate area. Fight fire remotely due to the risk of explosion. P283:Wear fire resistant or flame retardant clothing. P420:Store separately. P330:Rinse mouth. P306+P360:IF ON CLOTHING: Rinse Immediately contaminated CLOTHING and SKIN with plenty of water before removing clothes. P301+P317:IF SWALLOWED: Get medical help. P317:Get emergency medical help. |
| WGK Germany | 3 |
| RTECS | SC7550000 |
| Class | 5.1, 6.1 |
| 1. Qi Liu, Yatong Liu, Zhiyong Xing, Yuntong Huang, Li Ling, Xinglin Mo. (2023) A novel dual-function probe for fluorescent turn-on recognition and differentiation of Al3+ and Ga3+ and its application. SPECTROCHIMICA ACTA PART A-MOLECULAR AND BIOMOLECULAR SPECTROSCOPY, 287 (122076). [PMID:36368269] [10.1016/j.saa.2022.122076] |
| 2. Minglun Li, Bilin Zhuang, Yuyuan Lu, Zhen-Gang Wang, Lijia An. (2017) Accurate Determination of Ion Polarizabilities in Aqueous Solutions. JOURNAL OF PHYSICAL CHEMISTRY B, 121 (26): (6416–6424). [PMID:28594180] [10.1021/acs.jpcb.7b04111] |
| 1. Qi Liu, Yatong Liu, Zhiyong Xing, Yuntong Huang, Li Ling, Xinglin Mo. (2023) A novel dual-function probe for fluorescent turn-on recognition and differentiation of Al3+ and Ga3+ and its application. SPECTROCHIMICA ACTA PART A-MOLECULAR AND BIOMOLECULAR SPECTROSCOPY, 287 (122076). [PMID:36368269] [10.1016/j.saa.2022.122076] |
| 2. Minglun Li, Bilin Zhuang, Yuyuan Lu, Zhen-Gang Wang, Lijia An. (2017) Accurate Determination of Ion Polarizabilities in Aqueous Solutions. JOURNAL OF PHYSICAL CHEMISTRY B, 121 (26): (6416–6424). [PMID:28594180] [10.1021/acs.jpcb.7b04111] |
I2404135