| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| B152083-25g | 25g | 9 | $31.90 | |
| B152083-100g | 100g | 6 | $112.90 |
| Synonyms | Di-2-ethylhexyl isophthalate | Isophthalic acid, bis(2-ethylhexyl) ester | Dioctyl isophthalate | BIS(2-ETHYLHEXYL)ISOPHTHALATE | Flexol plasticizer 380 | DOIP | NSC 6358 | bis(2-ethylhexyl) benzene-1,3-dicarboxylate |
|---|---|
| Specifications & Purity | ≥98%(GC) |
| Shipped In | Normal |
| Pubchem Sid | 488180870 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488180870 |
| IUPAC Name | bis(2-ethylhexyl) benzene-1,3-dicarboxylate |
| INCHI | InChI=1S/C24H38O4/c1-5-9-12-19(7-3)17-27-23(25)21-14-11-15-22(16-21)24(26)28-18-20(8-4)13-10-6-2/h11,14-16,19-20H,5-10,12-13,17-18H2,1-4H3 |
| InChi Key | WXZOXVVKILCOPG-UHFFFAOYSA-N |
| Canonical SMILES | CCCCC(CC)COC(=O)C1=CC(=CC=C1)C(=O)OCC(CC)CCCC |
| Isomeric SMILES | CCCCC(CC)COC(=O)C1=CC(=CC=C1)C(=O)OCC(CC)CCCC |
| RTECS | NT2050000 |
| PubChem CID | 8733 |
| Molecular Weight | 390.56 |
| Reaxy-Rn | 2162836 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
 F2417144 | Certificate of Analysis | Jun 06, 2024 | B152083 |
| F2417151 | Certificate of Analysis | Jun 06, 2024 | B152083 |
| K2211378 | Certificate of Analysis | Nov 15, 2022 | B152083 |
| J1809043 | Certificate of Analysis | Aug 08, 2022 | B152083 |
| G2222147 | Certificate of Analysis | Jun 17, 2022 | B152083 |
| G2222115 | Certificate of Analysis | Jun 17, 2022 | B152083 |
| C2316892 | Certificate of Analysis | Jun 17, 2022 | B152083 |
| Refractive Index | 1.4860 to 1.4900 |
|---|---|
| Flash Point(°C) | 233°C |
| Boil Point(°C) | 211°C |
| Molecular Weight | 390.600 g/mol |
| XLogP3 | 7.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 16 |
| Exact Mass | 390.277 Da |
| Monoisotopic Mass | 390.277 Da |
| Topological Polar Surface Area | 52.600 Ų |
| Heavy Atom Count | 28 |
| Formal Charge | 0 |
| Complexity | 396.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| Pictogram(s) | GHS08, GHS09 |
|---|---|
| Signal | Danger |
| Hazard Statements | H400:Very toxic to aquatic life H360:May damage fertility or the unborn child |
| Precautionary Statements | P273:Avoid release to the environment. P280:Wear protective gloves/protective clothing/eye protection/face protection. P405:Store locked up. P501:Dispose of contents/container to ... P391:Collect spillage. P203:Obtain, read and follow all safety instructions before use. P318:if exposed or concerned, get medical advice. |
| RTECS | NT2050000 |
| Reaxy-Rn | 2162836 |
| Class | 9 |
