| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| C153446-50mg | 50mg | 3 | $50.90 | |
| C153446-200mg | 200mg | 3 | $153.90 | |
| C153446-1g | 1g | 5 | $692.90 |
| Synonyms | 5-(1,3-benzothiazol-2-yl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one | 10-(1,3-Benzothiazol-2-yl)-2,3,6,7-tetrahydro-1H,5H-11H- [1]benzopyrano[6,7,8-ij]-quinoliz-11-one1 | 1H,5H,11H-[1]Benzopyrano[6,7,8-ij]quinolizin-11-o |
|---|---|
| Specifications & Purity | ≥97%(HPLC) |
| Shipped In | Normal |
| Pubchem Sid | 504763269 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504763269 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| INCHI | InChI=1S/C22H18N2O2S/c25-22-16(21-23-17-7-1-2-8-18(17)27-21)12-14-11-13-5-3-9-24-10-4-6-15(19(13)24)20(14)26-22/h1-2,7-8,11-12H,3-6,9-10H2 |
| InChi Key | WYZWJLZUSHFFOR-UHFFFAOYSA-N |
| Canonical SMILES | C1CC2=C3C(=C4C(=C2)C=C(C(=O)O4)C5=NC6=CC=CC=C6S5)CCCN3C1 |
| Isomeric SMILES | C1CC2=C3C(=C4C(=C2)C=C(C(=O)O4)C5=NC6=CC=CC=C6S5)CCCN3C1 |
| PubChem CID | 5237252 |
| Molecular Weight | 374.46 |
| Reaxy-Rn | 9015159 |
| Sensitivity | Light Sensitive |
|---|---|
| Melt Point(°C) | 254 °C |
| Molecular Weight | 374.500 g/mol |
| XLogP3 | 4.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Exact Mass | 374.109 Da |
| Monoisotopic Mass | 374.109 Da |
| Topological Polar Surface Area | 70.700 Ų |
| Heavy Atom Count | 27 |
| Formal Charge | 0 |
| Complexity | 652.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| Pictogram(s) | GHS07 |
|---|---|
| Signal | Warning |
| Hazard Statements | H315:Causes skin irritation H319:Causes serious eye irritation |
| Precautionary Statements | P305+P351+P338:IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses if present and easy to do - continue rinsing. P280:Wear protective gloves/protective clothing/eye protection/face protection. P302+P352:IF ON SKIN: wash with plenty of water. P321:Specific treatment (see ... on this label). P264:Wash hands [and …] thoroughly after handling. P362+P364:Take off contaminated clothing and wash it before reuse. P264+P265:Wash hands [and …] thoroughly after handling. Do not touch eyes. P337+P317:If eye irritation persists: Get medical help. P332+P317:If skin irritation occurs: Get medical help. |
| Reaxy-Rn | 9015159 |
K2214381