The store will not work correctly when cookies are disabled.
Cresyl Diphenyl Phosphate (so called) (mixture of analogue) - ≥93.0%(GC), high purity , CAS No.26444-49-5
Basic Description
| Synonyms | DSSTox_RID_77555 | PHENYL P-TOLYL PHOSPHATE ((PHO)2(C7H7O)PO) | Diphenyl p-tolyl phosphate (mixture of analogue) | X0UF1XXO1Q | Diphenyl4-tolylphosphate | (4-methylphenyl) diphenyl phosphate | p-Cresyl diphenyl phosphate. | AKOS015899069 | DSSTox_CID_4861 |
|---|
| Specifications & Purity | ≥93%(GC) |
|---|
| Shipped In | Normal |
|---|
Names and Identifiers
| Pubchem Sid | 488180087 |
|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488180087 |
|---|
| Isomeric SMILES | CC1=CC=C(C=C1)OP(=O)(OC2=CC=CC=C2)OC3=CC=CC=C3 |
|---|
| RTECS | TC5520000 |
|---|
| PubChem CID | 6528 |
|---|
Certificates（CoA,COO,BSE/TSE and Analysis Chart)
Chemical and Physical Properties
| Refractive Index | 1.56 |
|---|
| Flash Point(°F) | 232°C(lit.) |
|---|
| Flash Point(°C) | 232°C(lit.) |
|---|
| Boil Point(°C) | 390 °C |
|---|
| Melt Point(°C) | -38 °C |
|---|
| Molecular Weight | 340.300 g/mol |
|---|
| XLogP3 | 5.000 |
|---|
| Hydrogen Bond Donor Count | 0 |
|---|
| Hydrogen Bond Acceptor Count | 4 |
|---|
| Rotatable Bond Count | 6 |
|---|
| Exact Mass | 340.086 Da |
|---|
| Monoisotopic Mass | 340.086 Da |
|---|
| Topological Polar Surface Area | 44.800 Ų |
|---|
| Heavy Atom Count | 24 |
|---|
| Formal Charge | 0 |
|---|
| Complexity | 384.000 |
|---|
| Isotope Atom Count | 0 |
|---|
| Defined Atom Stereocenter Count | 0 |
|---|
| Undefined Atom Stereocenter Count | 0 |
|---|
| Defined Bond Stereocenter Count | 0 |
|---|
| Undefined Bond Stereocenter Count | 0 |
|---|
| The total count of all stereochemical bonds | 0 |
|---|
| Covalently-Bonded Unit Count | 1 |
|---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator
F2406086