| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| S135591-1g | 1g | 3 | $117.90 | |
| S135591-5g | 5g | 3 | $398.90 | |
| S135591-25g | 25g | 3 | $1,791.90 |
| Synonyms | (R)-benzyl 2-amino-3-(1H-indol-3-yl)propanoate hydrochloride | AKOS015847215 | MFCD00237293 | benzyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride | H-D-Trp-OBzl.HCl | D-Tryptophan Benzyl Ester Hydrochloride | T2438 | D-Tryptophan,phenylmethyl es |
|---|---|
| Specifications & Purity | ≥98%(N) |
| Shipped In | Normal |
| Pubchem Sid | 488201034 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488201034 |
| IUPAC Name | benzyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride |
| INCHI | InChI=1S/C18H18N2O2.ClH/c19-16(18(21)22-12-13-6-2-1-3-7-13)10-14-11-20-17-9-5-4-8-15(14)17;/h1-9,11,16,20H,10,12,19H2;1H/t16-;/m1./s1 |
| InChi Key | DOKDMGOWZOTZRA-PKLMIRHRSA-N |
| Canonical SMILES | C1=CC=C(C=C1)COC(=O)C(CC2=CNC3=CC=CC=C32)N.Cl |
| Isomeric SMILES | C1=CC=C(C=C1)COC(=O)[C@@H](CC2=CNC3=CC=CC=C32)N.Cl |
| PubChem CID | 44629900 |
| Molecular Weight | 330.81 |
| Reaxy-Rn | 4618335 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
 E2330900 | Certificate of Analysis | Mar 04, 2025 | S135591 |
| E2330901 | Certificate of Analysis | Mar 04, 2025 | S135591 |
| E2330896 | Certificate of Analysis | Mar 04, 2025 | S135591 |
| E2330881 | Certificate of Analysis | Mar 04, 2025 | S135591 |
| E2330902 | Certificate of Analysis | Mar 04, 2025 | S135591 |
| E2330884 | Certificate of Analysis | Mar 04, 2025 | S135591 |
| E1528157 | Certificate of Analysis | Jan 11, 2023 | S135591 |
| Specific Rotation[α] | -32° (C=1,DMF) |
|---|---|
| Melt Point(°C) | 215°C(lit.) |
| Molecular Weight | 330.800 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 6 |
| Exact Mass | 330.114 Da |
| Monoisotopic Mass | 330.114 Da |
| Topological Polar Surface Area | 68.100 Ų |
| Heavy Atom Count | 23 |
| Formal Charge | 0 |
| Complexity | 368.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
| Reaxy-Rn | 4618335 |
|---|
