The store will not work correctly when cookies are disabled.
Diethyl adipate - reagent grade,99.0%, high purity , CAS No.141-28-6
Basic Description
| Synonyms | SCHEMBL50610 | CHEBI:34697 | Diethyl adipate, >=99%, FG | EN300-19693 | Diethyl adipate, analytical standard | Ethyl adipate | DS-5105 | A0162 | AI3-00342 | DUB DEA | DIETHYL ADIPATE [INCI] | Diethyl hexanedioate | F1905-6995 | A807746 | MFCD00009215 | 1, |
|---|
| Specifications & Purity | CP, ≥99% |
|---|
| Shipped In | Normal |
|---|
| Grade | CP |
|---|
Names and Identifiers
| Pubchem Sid | 488180891 |
|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488180891 |
|---|
| IUPAC Name | diethyl hexanedioate |
|---|
| INCHI | InChI=1S/C10H18O4/c1-3-13-9(11)7-5-6-8-10(12)14-4-2/h3-8H2,1-2H3 |
|---|
| InChi Key | VIZORQUEIQEFRT-UHFFFAOYSA-N |
|---|
| Canonical SMILES | CCOC(=O)CCCCC(=O)OCC |
|---|
| Isomeric SMILES | CCOC(=O)CCCCC(=O)OCC |
|---|
| WGK Germany | 2 |
|---|
| RTECS | AV1100000 |
|---|
| PubChem CID | 8844 |
|---|
| Molecular Weight | 202.25 |
|---|
| Beilstein | 1780035 |
|---|
| Reaxy-Rn | 1780035 |
|---|
Certificates（CoA,COO,BSE/TSE and Analysis Chart)
Chemical and Physical Properties
| Solubility | Insoluble in water; Soluble in Ether,Alcohol |
|---|
| Sensitivity | Moisture sensitive. |
|---|
| Refractive Index | 1.4272 |
|---|
| Flash Point(°F) | 110℃ |
|---|
| Flash Point(°C) | 110℃ |
|---|
| Boil Point(°C) | 251°C |
|---|
| Melt Point(°C) | -18°C |
|---|
| Molecular Weight | 202.250 g/mol |
|---|
| XLogP3 | 1.300 |
|---|
| Hydrogen Bond Donor Count | 0 |
|---|
| Hydrogen Bond Acceptor Count | 4 |
|---|
| Rotatable Bond Count | 9 |
|---|
| Exact Mass | 202.121 Da |
|---|
| Monoisotopic Mass | 202.121 Da |
|---|
| Topological Polar Surface Area | 52.600 Ų |
|---|
| Heavy Atom Count | 14 |
|---|
| Formal Charge | 0 |
|---|
| Complexity | 157.000 |
|---|
| Isotope Atom Count | 0 |
|---|
| Defined Atom Stereocenter Count | 0 |
|---|
| Undefined Atom Stereocenter Count | 0 |
|---|
| Defined Bond Stereocenter Count | 0 |
|---|
| Undefined Bond Stereocenter Count | 0 |
|---|
| The total count of all stereochemical bonds | 0 |
|---|
| Covalently-Bonded Unit Count | 1 |
|---|
Safety and Hazards(GHS)
| WGK Germany | 2 |
|---|
| RTECS | AV1100000 |
|---|
| Reaxy-Rn | 1780035 |
|---|
| Merck Index | 162 |
|---|
Citations of This Product
| 1. Yuheng Fu, Zhiwei Ye, Shixian Zhang, Shan Wang, Chuanxi Xiong. (2022) Enhanced piezoelectricity in polyvinyl chloride film plasticized by diethyl adipate. COLLOIDS AND SURFACES A-PHYSICOCHEMICAL AND ENGINEERING ASPECTS, 648 (129253). [PMID:] [10.1016/j.colsurfa.2022.129253] |
References
| 1. Yuheng Fu, Zhiwei Ye, Shixian Zhang, Shan Wang, Chuanxi Xiong. (2022) Enhanced piezoelectricity in polyvinyl chloride film plasticized by diethyl adipate. COLLOIDS AND SURFACES A-PHYSICOCHEMICAL AND ENGINEERING ASPECTS, 648 (129253). [PMID:] [10.1016/j.colsurfa.2022.129253] |
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator
I2028037
