| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| D155696-1g | 1g | 3 | $26.90 | |
| D155696-5g | 5g | 3 | $103.90 | |
| D155696-25g | 25g | 3 | $308.90 |
| Synonyms | Dimethyl pimelimidate dihydrochloride | Dimethyl pimelimidate dihydrochloride, >=99.0% (AT) | Dimethyl Pimelimidate Dihydrochloride [Cross-linking Agent for Peptides Research] | dimethyl heptanediimidate;dihydrochloride | Dimethyl pimelimidate dihydrochlo |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Store at -20°C,Argon charged |
| Shipped In | Ice chest + Ice pads |
| Pubchem Sid | 504766385 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504766385 |
| IUPAC Name | dimethyl heptanediimidate;dihydrochloride |
| INCHI | InChI=1S/C9H18N2O2.2ClH/c1-12-8(10)6-4-3-5-7-9(11)13-2;;/h10-11H,3-7H2,1-2H3;2*1H |
| InChi Key | LRHXBHUTQWIZTN-UHFFFAOYSA-N |
| Canonical SMILES | COC(=N)CCCCCC(=N)OC.Cl.Cl |
| Isomeric SMILES | COC(=N)CCCCCC(=N)OC.Cl.Cl |
| PubChem CID | 11402688 |
| Molecular Weight | 259.17 |
| Reaxy-Rn | 14435805 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
 J2029084 | Certificate of Analysis | Aug 20, 2024 | D155696 |
| J2029085 | Certificate of Analysis | Aug 20, 2024 | D155696 |
| I2412343 | Certificate of Analysis | Apr 02, 2024 | D155696 |
| D2412057 | Certificate of Analysis | Jun 28, 2022 | D155696 |
| I2208725 | Certificate of Analysis | Jun 28, 2022 | D155696 |
| I2208726 | Certificate of Analysis | Jun 28, 2022 | D155696 |
| Solubility | solubility H2O: 10 mg/mL; |
|---|---|
| Sensitivity | Heat sensitive;Moisture sensitive |
| Molecular Weight | 259.170 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 8 |
| Exact Mass | 258.09 Da |
| Monoisotopic Mass | 258.09 Da |
| Topological Polar Surface Area | 66.200 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 151.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |
| Pictogram(s) | GHS07 |
|---|---|
| Signal | Warning |
| Hazard Statements | H315:Causes skin irritation |
| Precautionary Statements | P280:Wear protective gloves/protective clothing/eye protection/face protection. P302+P352:IF ON SKIN: wash with plenty of water. P321:Specific treatment (see ... on this label). P264:Wash hands [and …] thoroughly after handling. P362+P364:Take off contaminated clothing and wash it before reuse. P332+P317:If skin irritation occurs: Get medical help. |
| Reaxy-Rn | 14435805 |
| Purity (Argentmetric Titration) | 97.5-102.5（%） |
|---|---|
| Proton NMR spectrum | Conforms to Structure |
