| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| E404396-250mg | 250mg | 4 | $46.90 | |
| E404396-1g | 1g | 3 | $83.90 | |
| E404396-5g | 5g | 3 | $333.90 |
| Specifications & Purity | ≥98% |
|---|
| Pubchem Sid | 488198256 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488198256 |
| IUPAC Name | ethyl N-(3,4-dichloroanilino)carbamate |
| INCHI | InChI=1S/C9H10Cl2N2O2/c1-2-15-9(14)13-12-6-3-4-7(10)8(11)5-6/h3-5,12H,2H2,1H3,(H,13,14) |
| InChi Key | JLVAIPOSBJQZGC-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)NNC1=CC(=C(C=C1)Cl)Cl |
| Isomeric SMILES | CCOC(=O)NNC1=CC(=C(C=C1)Cl)Cl |
| PubChem CID | 12787057 |
| Molecular Weight | 249.09 |
| Reaxy-Rn | 1821470 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
 C2304483 | Certificate of Analysis | Dec 21, 2022 | E404396 |
| C2304589 | Certificate of Analysis | Dec 21, 2022 | E404396 |
| C2304509 | Certificate of Analysis | Dec 21, 2022 | E404396 |
| C2304582 | Certificate of Analysis | Dec 21, 2022 | E404396 |
| C2304588 | Certificate of Analysis | Dec 21, 2022 | E404396 |
| Solubility | Soluble in Methanol |
|---|---|
| Melt Point(°C) | 112 °C |
| Molecular Weight | 249.090 g/mol |
| XLogP3 | 3.400 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 4 |
| Exact Mass | 248.012 Da |
| Monoisotopic Mass | 248.012 Da |
| Topological Polar Surface Area | 50.400 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 216.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| Reaxy-Rn | 1821470 |
|---|
