The store will not work correctly when cookies are disabled.
Lithium Pyruvate Monohydrate [Guaranteed for Standard to GOT, GPT] - >95.0%(T), high purity , CAS No.2922-61-4
Basic Description
| Synonyms | MFCD00036136 | lithium;2-oxopropanoate | lithium 2-oxopropanoate | DTXSID70883908 | A876506 | P0659 | Propanoic acid, 2-oxo-, lithium salt (1:1) | Lithium Pyruvate Monohydrate [Guaranteed for Standard to GOT, GPT] | lithium(1+) 2-oxopropanoate | Propanoic |
|---|
| Specifications & Purity | ≥95%(T) |
|---|
| Storage Temp | Store at 2-8°C |
|---|
| Shipped In | Wet ice |
|---|
Names and Identifiers
| IUPAC Name | lithium;2-oxopropanoate |
|---|
| INCHI | InChI=1S/C3H4O3.Li/c1-2(4)3(5)6;/h1H3,(H,5,6);/q;+1/p-1 |
|---|
| InChi Key | OFJHGWPRBMPXCX-UHFFFAOYSA-M |
|---|
| Canonical SMILES | [Li+].CC(=O)C(=O)[O-] |
|---|
| Isomeric SMILES | [Li+].CC(=O)C(=O)[O-] |
|---|
| PubChem CID | 23663618 |
|---|
| Molecular Weight | 112.01 |
|---|
| Reaxy-Rn | 4885820 |
|---|
Certificates（CoA,COO,BSE/TSE and Analysis Chart)
Chemical and Physical Properties
| Solubility | Slightly soluble in water |
|---|
| Sensitivity | Heat Sensitive |
|---|
| Molecular Weight | 94.000 g/mol |
|---|
| XLogP3 | |
|---|
| Hydrogen Bond Donor Count | 0 |
|---|
| Hydrogen Bond Acceptor Count | 3 |
|---|
| Rotatable Bond Count | 1 |
|---|
| Exact Mass | 94.0242 Da |
|---|
| Monoisotopic Mass | 94.0242 Da |
|---|
| Topological Polar Surface Area | 57.200 Ų |
|---|
| Heavy Atom Count | 7 |
|---|
| Formal Charge | 0 |
|---|
| Complexity | 88.200 |
|---|
| Isotope Atom Count | 0 |
|---|
| Defined Atom Stereocenter Count | 0 |
|---|
| Undefined Atom Stereocenter Count | 0 |
|---|
| Defined Bond Stereocenter Count | 0 |
|---|
| Undefined Bond Stereocenter Count | 0 |
|---|
| The total count of all stereochemical bonds | 0 |
|---|
| Covalently-Bonded Unit Count | 2 |
|---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator
L2205251
