| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| A124646-50mg | 50mg | 2 | $39.90 | |
| A124646-250mg | 250mg | 2 | $151.90 | |
| A124646-1g | 1g | 2 | $467.90 |
| Synonyms | [(2-Aminoethyl)amino]acetic acid, AldrichCPR | 2-(2-aminoethylamino)acetic acid | Ethylenediamine-N-monoacetic Acid | SB74074 | N-beta-aminoethyl-Gly-OH | N- -Aminoethyl-Gly-OH | N--Aminoethyl-Gly-OH | EN300-176094 | Glycine, N-(2-aminoethyl)- | A18507 | |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
| Pubchem Sid | 504758677 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504758677 |
| IUPAC Name | 2-(2-aminoethylamino)acetic acid |
| INCHI | InChI=1S/C4H10N2O2/c5-1-2-6-3-4(7)8/h6H,1-3,5H2,(H,7,8) |
| InChi Key | PIINGYXNCHTJTF-UHFFFAOYSA-N |
| Canonical SMILES | C(CNCC(=O)O)N |
| Isomeric SMILES | C(CNCC(=O)O)N |
| PubChem CID | 428913 |
| Molecular Weight | 118.14 |
| Solubility | Soluble in Methanol and Water |
|---|---|
| Melt Point(°C) | 143°C |
| Molecular Weight | 118.130 g/mol |
| XLogP3 | -3.800 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 118.074 Da |
| Monoisotopic Mass | 118.074 Da |
| Topological Polar Surface Area | 75.400 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 74.400 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| Pictogram(s) | GHS07 |
|---|---|
| Signal | Warning |
| Hazard Statements | H319:Causes serious eye irritation |
| Precautionary Statements | P305+P351+P338:IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses if present and easy to do - continue rinsing. P280:Wear protective gloves/protective clothing/eye protection/face protection. P264+P265:Wash hands [and …] thoroughly after handling. Do not touch eyes. P337+P317:If eye irritation persists: Get medical help. |
| 1. Daoyuan Zu, Haoran Song, Changping Li, Yuwei Wang, Rong Du, Rui Zhou, Wei Zhang, Shiting Pan, Yang Cai, Yongming Shen, Zhifeng Yang. (2022) Understanding the self-catalyzed decomplexation mechanism of Cu-EDTA in Ti3C2Tx MXene/peroxymonosulfate process. APPLIED CATALYSIS B-ENVIRONMENTAL, 306 (121131). [PMID:] [10.1016/j.apcatb.2022.121131] |
| 1. Daoyuan Zu, Haoran Song, Changping Li, Yuwei Wang, Rong Du, Rui Zhou, Wei Zhang, Shiting Pan, Yang Cai, Yongming Shen, Zhifeng Yang. (2022) Understanding the self-catalyzed decomplexation mechanism of Cu-EDTA in Ti3C2Tx MXene/peroxymonosulfate process. APPLIED CATALYSIS B-ENVIRONMENTAL, 306 (121131). [PMID:] [10.1016/j.apcatb.2022.121131] |
K2316022