| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| N159195-250mg | 250mg | 3 | $114.90 | |
| N159195-1g | 1g | 6 | $311.90 | |
| N159195-5g | 5g | 1 | $1,244.90 |
| Specifications & Purity | ≥97% |
|---|---|
| Storage Temp | Argon charged |
| Shipped In | Normal |
| Pubchem Sid | 488201052 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488201052 |
| IUPAC Name | 2-(3-aminopropylamino)acetic acid;dihydrochloride |
| INCHI | InChI=1S/C5H12N2O2.2ClH/c6-2-1-3-7-4-5(8)9;;/h7H,1-4,6H2,(H,8,9);2*1H |
| InChi Key | JQQTXSWVGCRXGJ-UHFFFAOYSA-N |
| Canonical SMILES | C(CN)CNCC(=O)O.Cl.Cl |
| Isomeric SMILES | C(CN)CNCC(=O)O.Cl.Cl |
| PubChem CID | 44630059 |
| Molecular Weight | 205.08 |
| Reaxy-Rn | 5826022 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
 H2324705 | Certificate of Analysis | Aug 09, 2023 | N159195 |
| H2324737 | Certificate of Analysis | Aug 09, 2023 | N159195 |
| H2324606 | Certificate of Analysis | Aug 09, 2023 | N159195 |
| H2324608 | Certificate of Analysis | Aug 09, 2023 | N159195 |
| H2324704 | Certificate of Analysis | Aug 09, 2023 | N159195 |
| H2324735 | Certificate of Analysis | Aug 09, 2023 | N159195 |
| Sensitivity | Moisture sensitive. |
|---|---|
| Molecular Weight | 205.080 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 5 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 5 |
| Exact Mass | 204.043 Da |
| Monoisotopic Mass | 204.043 Da |
| Topological Polar Surface Area | 75.400 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 85.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |
| Reaxy-Rn | 5826022 |
|---|
