| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| N159610-1g | 1g | 3 | $11.90 | |
| N159610-5g | 5g | 3 | $43.90 | |
| N159610-25g | 25g | 2 | $144.90 |
| Synonyms | N-Benzyloxycarbonyl-D-leucine | SCHEMBL2366985 | AC-17156 | AM81875 | N-Carbobenzoxy-D-leucine | C2839 | HY-Y0555A | D-N-(Benzyloxycarbonyl)leucine | MFCD00025090 | ((Benzyloxy)carbonyl)-D-leucine | AKOS010398198 | Benzylcarbazate | BENZOIC ACID, O-HYDRAZ |
|---|---|
| Specifications & Purity | ≥97%(HPLC) |
| Shipped In | Normal |
| Pubchem Sid | 504764473 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504764473 |
| IUPAC Name | (2R)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid |
| INCHI | InChI=1S/C14H19NO4/c1-10(2)8-12(13(16)17)15-14(18)19-9-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3,(H,15,18)(H,16,17)/t12-/m1/s1 |
| InChi Key | USPFMEKVPDBMCG-GFCCVEGCSA-N |
| Canonical SMILES | CC(C)CC(C(=O)O)NC(=O)OCC1=CC=CC=C1 |
| Isomeric SMILES | CC(C)C[C@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
| PubChem CID | 7000099 |
| Molecular Weight | 265.31 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
 C2005035 | Certificate of Analysis | Dec 19, 2023 | N159610 |
| Specific Rotation[α] | 17° (C=5,EtOH) |
|---|---|
| Flash Point(°C) | 222 °C |
| Molecular Weight | 265.300 g/mol |
| XLogP3 | 2.800 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 7 |
| Exact Mass | 265.131 Da |
| Monoisotopic Mass | 265.131 Da |
| Topological Polar Surface Area | 75.600 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 298.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
