| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| N159598-1g | 1g | 2 | $25.90 | |
| N159598-5g | 5g | 1 | $76.90 | |
| N159598-10g | 10g | 1 | $138.90 | |
| N159598-25g | 25g | 1 | $311.90 |
| Synonyms | 2-(((Benzyloxy)carbonyl)amino)-3-(1H-indol-3-yl)propanoic acid | MFCD11112234 | 1-(piperidin-4-yl)piperidine DiHCl | AB01681 | AB02665 | DL-Tryptophan, N-[(phenylmethoxy)carbonyl] | DL-Tryptophan, N-[(phenylmethoxy)carbonyl]- | N-Benzyloxycarbonyl-DL-tryp |
|---|---|
| Specifications & Purity | ≥97%(T) |
| Storage Temp | Argon charged |
| Shipped In | Normal |
| Pubchem Sid | 504756395 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504756395 |
| IUPAC Name | 3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| INCHI | InChI=1S/C19H18N2O4/c22-18(23)17(10-14-11-20-16-9-5-4-8-15(14)16)21-19(24)25-12-13-6-2-1-3-7-13/h1-9,11,17,20H,10,12H2,(H,21,24)(H,22,23) |
| InChi Key | AHYFYYVVAXRMKB-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)COC(=O)NC(CC2=CNC3=CC=CC=C32)C(=O)O |
| Isomeric SMILES | C1=CC=C(C=C1)COC(=O)NC(CC2=CNC3=CC=CC=C32)C(=O)O |
| PubChem CID | 98198 |
| Molecular Weight | 338.36 |
| Reaxy-Rn | 96745 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
 I1918131 | Certificate of Analysis | Jul 10, 2023 | N159598 |
| Sensitivity | air sensitive |
|---|---|
| Melt Point(°C) | 166.0to171.0℃ |
| Molecular Weight | 338.400 g/mol |
| XLogP3 | 2.300 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 7 |
| Exact Mass | 338.127 Da |
| Monoisotopic Mass | 338.127 Da |
| Topological Polar Surface Area | 91.400 Ų |
| Heavy Atom Count | 25 |
| Formal Charge | 0 |
| Complexity | 464.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| Reaxy-Rn | 96745 |
|---|
