| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| N159609-1g | 1g | 10 | $13.90 | |
| N159609-5g | 5g | 10 | $53.90 | |
| N159609-25g | 25g | 3 | $180.90 | |
| N159609-100g | 100g | 1 | $649.90 |
| Synonyms | N-Cbz-L-serine benzyl ester | STL368740 | EN300-6479749 | AKOS015889964 | AM82231 | Z-SER-OBZL | (S)-benzyl 2-(benzyloxycarbonylamino)-3-hydroxypropanoate | CS-0037004 | DS-15090 | N-Z-L-Serine benzyl ester, 97% | DTXSID40426341 | F10758 | benzyl (2S)-3-h |
|---|---|
| Specifications & Purity | ≥97%(HPLC) |
| Shipped In | Normal |
| Pubchem Sid | 488195939 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488195939 |
| IUPAC Name | benzyl (2S)-3-hydroxy-2-(phenylmethoxycarbonylamino)propanoate |
| INCHI | InChI=1S/C18H19NO5/c20-11-16(17(21)23-12-14-7-3-1-4-8-14)19-18(22)24-13-15-9-5-2-6-10-15/h1-10,16,20H,11-13H2,(H,19,22)/t16-/m0/s1 |
| InChi Key | MHHDPGHZHFJLBZ-INIZCTEOSA-N |
| Canonical SMILES | C1=CC=C(C=C1)COC(=O)C(CO)NC(=O)OCC2=CC=CC=C2 |
| Isomeric SMILES | C1=CC=C(C=C1)COC(=O)[C@H](CO)NC(=O)OCC2=CC=CC=C2 |
| WGK Germany | 3 |
| PubChem CID | 6992970 |
| Molecular Weight | 329.35 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
 H2202396 | Certificate of Analysis | Jun 17, 2022 | N159609 |
| H2202395 | Certificate of Analysis | Jun 17, 2022 | N159609 |
| D23231307 | Certificate of Analysis | Jun 17, 2022 | N159609 |
| D23231294 | Certificate of Analysis | Jan 27, 2022 | N159609 |
| C1815091 | Certificate of Analysis | Jan 27, 2022 | N159609 |
| C1815090 | Certificate of Analysis | Jan 27, 2022 | N159609 |
| Solubility | Slightly soluble in water. |
|---|---|
| Specific Rotation[α] | [α]D 5° (C=1,CHCl3) |
| Melt Point(°C) | 85 ℃ |
| Molecular Weight | 329.300 g/mol |
| XLogP3 | 2.200 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 9 |
| Exact Mass | 329.126 Da |
| Monoisotopic Mass | 329.126 Da |
| Topological Polar Surface Area | 84.900 Ų |
| Heavy Atom Count | 24 |
| Formal Charge | 0 |
| Complexity | 389.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| WGK Germany | 3 |
|---|
