| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| N105656-250mg | 250mg | 3 | $42.90 | |
| N105656-1g | 1g | 10 | $131.90 | |
| N105656-5g | 5g | 1 | $391.90 |
| Synonyms | NPB | NPD | N,N'-Biphenyl-N,N'-bis-(1-naphthenyl)-[1,1'-biphenyl]-4,4'-diamine | N,N'-Di(1-naphthyl)-N,N'-diphenyl-(1,1'-biphenyl)-4,4'-diamine, 96% | MFCD03093246 | N,N'-di(l-naphthyl)-N,N'-diphenyl-4,4'-diaminobiphenyl | N4,N4'-Di(1-naphthyl)-N4,N4'-dip |
|---|---|
| Specifications & Purity | sublimed grade, ≥99% |
| Storage Temp | Room temperature,Argon charged |
| Shipped In | Normal |
| Grade | sublimed grade |
| Product Description | Usually Hole transporting material for OLED devices. |
| Pubchem Sid | 488195073 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488195073 |
| IUPAC Name | N-[4-[4-(N-naphthalen-1-ylanilino)phenyl]phenyl]-N-phenylnaphthalen-1-amine |
| INCHI | InChI=1S/C44H32N2/c1-3-17-37(18-4-1)45(43-23-11-15-35-13-7-9-21-41(35)43)39-29-25-33(26-30-39)34-27-31-40(32-28-34)46(38-19-5-2-6-20-38)44-24-12-16-36-14-8-10-22-42(36)44/h1-32H |
| InChi Key | IBHBKWKFFTZAHE-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)N(C2=CC=C(C=C2)C3=CC=C(C=C3)N(C4=CC=CC=C4)C5=CC=CC6=CC=CC=C65)C7=CC=CC8=CC=CC=C87 |
| Isomeric SMILES | C1=CC=C(C=C1)N(C2=CC=C(C=C2)C3=CC=C(C=C3)N(C4=CC=CC=C4)C5=CC=CC6=CC=CC=C65)C7=CC=CC8=CC=CC=C87 |
| WGK Germany | 3 |
| PubChem CID | 5069127 |
| Molecular Weight | 588.74 |
| Reaxy-Rn | 8022378 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
 I1622012 | Certificate of Analysis | May 09, 2024 | N105656 |
| E2027116 | Certificate of Analysis | Mar 12, 2024 | N105656 |
| C2215145 | Certificate of Analysis | Jan 22, 2022 | N105656 |
| C2215126 | Certificate of Analysis | Jan 22, 2022 | N105656 |
| C2215075 | Certificate of Analysis | Jan 22, 2022 | N105656 |
| Sensitivity | air sensitive |
|---|---|
| Boil Point(°C) | 772.5ºC |
| Melt Point(°C) | 279-283°C |
| Molecular Weight | 588.700 g/mol |
| XLogP3 | 12.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 7 |
| Exact Mass | 588.257 Da |
| Monoisotopic Mass | 588.257 Da |
| Topological Polar Surface Area | 6.500 Ų |
| Heavy Atom Count | 46 |
| Formal Charge | 0 |
| Complexity | 829.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| Signal | Warning |
|---|---|
| Hazard Statements | H315:Causes skin irritation H319:Causes serious eye irritation H335:May cause respiratory irritation H302:Harmful if swallowed |
| Precautionary Statements | P261:Avoid breathing dust/fume/gas/mist/vapors/spray. P305+P351+P338:IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses if present and easy to do - continue rinsing. |
| WGK Germany | 3 |
| Reaxy-Rn | 8022378 |
