| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| N159565-200mg | 200mg | 9 | $39.90 | |
| N159565-1g | 1g | ≥10 | $150.90 | |
| N159565-5g | 5g | ≥10 | $516.90 |
| Specifications & Purity | ≥98% |
|---|---|
| Shipped In | Normal |
| Pubchem Sid | 488198620 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488198620 |
| IUPAC Name | 1-N,4-N-bis(3-methylphenyl)-1-N,4-N-diphenylbenzene-1,4-diamine |
| INCHI | InChI=1S/C32H28N2/c1-25-11-9-17-31(23-25)33(27-13-5-3-6-14-27)29-19-21-30(22-20-29)34(28-15-7-4-8-16-28)32-18-10-12-26(2)24-32/h3-24H,1-2H3 |
| InChi Key | ZWZXDJMNYGRYNP-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=CC=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)N(C4=CC=CC=C4)C5=CC=CC(=C5)C |
| Isomeric SMILES | CC1=CC(=CC=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)N(C4=CC=CC=C4)C5=CC=CC(=C5)C |
| PubChem CID | 14250518 |
| Molecular Weight | 440.59 |
| Reaxy-Rn | 8013763 |
| Melt Point(°C) | 173 °C |
|---|---|
| Molecular Weight | 440.600 g/mol |
| XLogP3 | 9.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 6 |
| Exact Mass | 440.225 Da |
| Monoisotopic Mass | 440.225 Da |
| Topological Polar Surface Area | 6.500 Ų |
| Heavy Atom Count | 34 |
| Formal Charge | 0 |
| Complexity | 532.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| Reaxy-Rn | 8013763 |
|---|
K2202699