| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| P160403-100mg | 100mg | 1 | $35.90 | |
| P160403-250mg | 250mg | 2 | $79.90 | |
| P160403-1g | 1g | 2 | $171.90 |
| Synonyms | DTXSID80421052 | MFCD00070617 | P0370 | 5-Ethylidene-3-phenyl-2-thiohydantoin | PTH-DELTA-threonine | T72657 | (5E)-5-ethylidene-3-phenyl-2-sulfanylideneimidazolidin-4-one | Phenylthiohydantoin-DELTA-threonine |
|---|---|
| Specifications & Purity | ≥90%(HPLC) |
| Shipped In | Normal |
| Pubchem Sid | 488195633 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488195633 |
| IUPAC Name | (5E)-5-ethylidene-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| INCHI | InChI=1S/C11H10N2OS/c1-2-9-10(14)13(11(15)12-9)8-6-4-3-5-7-8/h2-7H,1H3,(H,12,15)/b9-2+ |
| InChi Key | SXYSWGDIVRMEDE-XNWCZRBMSA-N |
| Canonical SMILES | CC=C1C(=O)N(C(=S)N1)C2=CC=CC=C2 |
| Isomeric SMILES | C/C=C/1\C(=O)N(C(=S)N1)C2=CC=CC=C2 |
| PubChem CID | 5818498 |
| Molecular Weight | 218.27 |
| Reaxy-Rn | 162590 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
 L2417135 | Certificate of Analysis | Jun 09, 2021 | P160403 |
| Melt Point(°C) | 236 °C |
|---|---|
| Molecular Weight | 218.280 g/mol |
| XLogP3 | 2.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 218.051 Da |
| Monoisotopic Mass | 218.051 Da |
| Topological Polar Surface Area | 64.400 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 319.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 1 |
| Covalently-Bonded Unit Count | 1 |
| Reaxy-Rn | 162590 |
|---|
