| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| P160220-100mg | 100mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $228.90 |
| Synonyms | NSC406006 | NSC-406006 | 3,4-Benzchrysene | Benzo[a]chrysene | P1893 | Benzo(a)chrysene | P2207 | Picene (purified by sublimation), >/=99.5% | CS-0159930 | Dibenzo(a,i)phenanthrene | 1,7,8-Dibenzphenanthrene | DTXSID8073895 | C19500 | WLN: L F6 E6 B666J | |
|---|---|
| Specifications & Purity | ≥99.9% |
| Storage Temp | Store at 2-8°C,Argon charged |
| Shipped In | Wet ice |
| IUPAC Name | picene |
|---|---|
| INCHI | InChI=1S/C22H14/c1-3-7-17-15(5-1)9-11-21-19(17)13-14-20-18-8-4-2-6-16(18)10-12-22(20)21/h1-14H |
| InChi Key | GBROPGWFBFCKAG-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C=CC3=C2C=CC4=C3C=CC5=CC=CC=C54 |
| Isomeric SMILES | C1=CC=C2C(=C1)C=CC3=C2C=CC4=C3C=CC5=CC=CC=C54 |
| PubChem CID | 9162 |
| Molecular Weight | 278.35 |
| Solubility | Insoluble in water; Very slightly soluble in Alcohol,Ether |
|---|---|
| Sensitivity | Light Sensitive,Air Sensitive,Heat Sensitive |
| Boil Point(°C) | 525°C(lit.) |
| Melt Point(°C) | 366°C(lit.) |
| Molecular Weight | 278.300 g/mol |
| XLogP3 | 7.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 278.11 Da |
| Monoisotopic Mass | 278.11 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 361.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| Pictogram(s) | GHS08 |
|---|---|
| Signal | Warning |
| Hazard Statements | H371:May cause damage to organs |
| Precautionary Statements | P405:Store locked up. P501:Dispose of contents/container to ... P264:Wash hands [and …] thoroughly after handling. P260:Do not breathe dust/fume/gas/mist/vapors/spray. P270:Do not eat, drink or smoke when using this product. P308+P316:IF exposed or concerned: Get emergency medical help immediately. |
| Merck Index | 7396 |
Starting at $219.90
