Determine the necessary mass, volume, or concentration for preparing a solution.
Basic Description
| Synonyms | Fmoc-L-Glu(tBu)-Wang TentaGel S (90 ?m, 0.2-0.25 mmol/g) | E76851 | 7-HYDROXY-5-METHYL-[1,2,4]TRIAZOLO[1,5-A]PYRIMIDINE-2-CARBOXYLICACID | MFCD00801252 | (4S)-4-[[9H-fluoren-9-ylmethoxy(oxo)methyl]amino]-5-oxopentanoic acid tert-butyl ester | Fmoc-L-Glu(t |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Names and Identifiers
| IUPAC Name | tert-butyl (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoate |
|---|---|
| INCHI | InChI=1S/C24H27NO5/c1-24(2,3)30-22(27)13-12-16(14-26)25-23(28)29-15-21-19-10-6-4-8-17(19)18-9-5-7-11-20(18)21/h4-11,14,16,21H,12-13,15H2,1-3H3,(H,25,28)/t16-/m0/s1 |
| InChi Key | BCIPGSZQUDLGSY-INIZCTEOSA-N |
| Canonical SMILES | CC(C)(C)OC(=O)CCC(C=O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
| Isomeric SMILES | CC(C)(C)OC(=O)CC[C@@H](C=O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
| PubChem CID | 10740259 |
| Molecular Weight | 280.303 |
Certificates（CoA,COO,BSE/TSE and Analysis Chart)
C of A & Other Certificates(BSE/TSE, COO):
Analytical Chart:
Chemical and Physical Properties
| Molecular Weight | 409.500 g/mol |
|---|---|
| XLogP3 | 3.800 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 10 |
| Exact Mass | 409.189 Da |
| Monoisotopic Mass | 409.189 Da |
| Topological Polar Surface Area | 81.700 Ų |
| Heavy Atom Count | 30 |
| Formal Charge | 0 |
| Complexity | 591.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |