| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| T162211-5g | 5g | 1 | $95.90 |
| Synonyms | SY111234 | 4-methylbenzenesulfonate;tetramethylazanium | tetramethylammonium tosylate | tetramethylammonium 4-methylbenzenesulfonate | D85922 | CS-0153046 | SCHEMBL216795 | Tetramethylammonium toluene-p-sulphonate | AKOS015840445 | MFCD00043173 | tetramet |
|---|---|
| Specifications & Purity | ≥99%(T) |
| Shipped In | Normal |
| Pubchem Sid | 504764221 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504764221 |
| IUPAC Name | 4-methylbenzenesulfonate;tetramethylazanium |
| INCHI | InChI=1S/C7H8O3S.C4H12N/c1-6-2-4-7(5-3-6)11(8,9)10;1-5(2,3)4/h2-5H,1H3,(H,8,9,10);1-4H3/q;+1/p-1 |
| InChi Key | FHVCZJGBXWNGIZ-UHFFFAOYSA-M |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].C[N+](C)(C)C |
| Isomeric SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].C[N+](C)(C)C |
| PubChem CID | 6451622 |
| Molecular Weight | 245.34 |
| Reaxy-Rn | 5195510 |
| Molecular Weight | 245.340 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 245.109 Da |
| Monoisotopic Mass | 245.109 Da |
| Topological Polar Surface Area | 65.600 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 212.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
| Pictogram(s) | GHS07 |
|---|---|
| Signal | Warning |
| Hazard Statements | H315:Causes skin irritation H319:Causes serious eye irritation |
| Precautionary Statements | P305+P351+P338:IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses if present and easy to do - continue rinsing. P280:Wear protective gloves/protective clothing/eye protection/face protection. P302+P352:IF ON SKIN: wash with plenty of water. P321:Specific treatment (see ... on this label). P264:Wash hands [and …] thoroughly after handling. P362+P364:Take off contaminated clothing and wash it before reuse. P264+P265:Wash hands [and …] thoroughly after handling. Do not touch eyes. P337+P317:If eye irritation persists: Get medical help. P332+P317:If skin irritation occurs: Get medical help. |
| Reaxy-Rn | 5195510 |
| Appearance(T162211) | White to Almost white powder to crystal |
|---|---|
| Purity(Ion exchange titration) | 98.5-101.5（%） |
| LC-MS for identification | Conforms |
| Proton NMR spectrum | Conforms to Structure |
J2312179