The store will not work correctly when cookies are disabled.
Tris(2,2,2-trifluoroethyl) Phosphate - >96.0%(GC), high purity , CAS No.358-63-4
Basic Description
Synonyms | Tris(2,2,2-trifluoroethyl)phosphate | tris(2,2,2-trifluoroethyl) phosphate | phosphoric acid tris(2,2,2-trifluoroethyl) ester |
Specifications & Purity | ≥96%(GC) |
Shipped In | Normal |
---|
Names and Identifiers
Pubchem Sid | 504758400 |
Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504758400 |
IUPAC Name | tris(2,2,2-trifluoroethyl) phosphate |
INCHI | InChI=1S/C6H6F9O4P/c7-4(8,9)1-17-20(16,18-2-5(10,11)12)19-3-6(13,14)15/h1-3H2 |
InChi Key | ZMQDTYVODWKHNT-UHFFFAOYSA-N |
Canonical SMILES | C(C(F)(F)F)OP(=O)(OCC(F)(F)F)OCC(F)(F)F |
Isomeric SMILES | C(C(F)(F)F)OP(=O)(OCC(F)(F)F)OCC(F)(F)F |
PubChem CID | 303454 |
Molecular Weight | 344.07 |
Reaxy-Rn | 1716316 |
---|
Certificates(CoA,COO,BSE/TSE and Analysis Chart)
Chemical and Physical Properties
Refractive Index | 1.32 |
Flash Point(°C) | 60 °C |
Boil Point(°C) | 40 °C/0.6 mmHg |
Melt Point(°C) | -22°C(lit.) |
Molecular Weight | 344.070 g/mol |
---|
XLogP3 | 2.900 |
---|
Hydrogen Bond Donor Count | 0 |
---|
Hydrogen Bond Acceptor Count | 13 |
---|
Rotatable Bond Count | 6 |
---|
Exact Mass | 343.986 Da |
---|
Monoisotopic Mass | 343.986 Da |
---|
Topological Polar Surface Area | 44.800 Ų |
---|
Heavy Atom Count | 20 |
---|
Formal Charge | 0 |
---|
Complexity | 294.000 |
---|
Isotope Atom Count | 0 |
---|
Defined Atom Stereocenter Count | 0 |
---|
Undefined Atom Stereocenter Count | 0 |
---|
Defined Bond Stereocenter Count | 0 |
---|
Undefined Bond Stereocenter Count | 0 |
---|
The total count of all stereochemical bonds | 0 |
---|
Covalently-Bonded Unit Count | 1 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator