Peptide Synthesis

Shop By
View as List Grid

4 Items

Set Descending Direction
  1. L-O-Phosphoserine(L-SOP), Agonist of mGlu 4 receptor;Agonist of mGlu 6 receptor;Agonist of mGlu 7 receptor;Agonist of mGlu 8 receptor
    Cas#: 407-41-0        Compound CID:  68841
    Formula:  C3H8NO6P        Molecular Weight: 185.07
    IUPAC Name: (2S)-2-amino-3-phosphonooxypropanoic acid
    SMILES: C(C(C(=O)O)N)OP(=O)(O)O
    InChIKey: BZQFBWGGLXLEPQ-REOHCLBHSA-N
    InChI: InChI=1S/C3H8NO6P/c4-2(3(5)6)1-10-11(7,8)9/h2H,1,4H2,(H,5,6)(H2,7,8,9)/t2-/m0/s1
    Synonyms: L-SOP | CAS-407-41-0 | H-Ser(PO3H2)-OH | Phosphatidalserine | A873241 | CCG-204968 | NCGC00261571-01 | s5137 | (2S)-2...
  2. O-Benzyl-L-serine, Inhibitor of Alanine/serine/cysteine transporter 2
    Cas#: 4726-96-9        Compound CID:  78457
    Formula:  C10H13NO3        Molecular Weight: 195.22
    IUPAC Name: (2S)-2-amino-3-phenylmethoxypropanoic acid
    SMILES: C1=CC=C(C=C1)COCC(C(=O)O)N
    InChIKey: IDGQXGPQOGUGIX-VIFPVBQESA-N
    InChI: InChI=1S/C10H13NO3/c11-9(10(12)13)7-14-6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)/t9-/m0/s1
    Synonyms: H-Ser(Bzl)-OH | AMY22660 | J-300251 | M06132 | HY-W008308 | Racemic O-(phenylmethyl)serine | B0861 | Z-O-benzyl-L-ser...
  3. S-Benzyl-L-cysteine, Inhibitor of Alanine/serine/cysteine transporter 2
    Cas#: 3054-01-1        Compound CID:  193613
    Formula:  C10H13NO2S        Molecular Weight: 211.28
    IUPAC Name: (2R)-2-amino-3-benzylsulfanylpropanoic acid
    SMILES: C1=CC=C(C=C1)CSCC(C(=O)O)N
    InChIKey: GHBAYRBVXCRIHT-VIFPVBQESA-N
    InChI: InChI=1S/C10H13NO2S/c11-9(10(12)13)7-14-6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)/t9-/m0/s1
    Synonyms: S-Benzyl-L-cysteine, 97% | NCGC00013519-02 | L-S-Benzylcysteine | NCGC00013519 | NCGC00096633-01 | Felixene | Benzylc...
  4. 3,3',5-Triiodo-L-thyronine, Thyroid hormone receptor agonist
    Cas#: 6893-02-3        Compound CID:  5920
    Formula:  C15H12I3NO4        Molecular Weight: 650.98
    IUPAC Name: (2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoic acid
    SMILES: C1=CC(=C(C=C1OC2=C(C=C(C=C2I)CC(C(=O)O)N)I)I)O
    InChIKey: AUYYCJSJGJYCDS-LBPRGKRZSA-N
    InChI: InChI=1S/C15H12I3NO4/c16-9-6-8(1-2-13(9)20)23-14-10(17)3-7(4-11(14)18)5-12(19)15(21)22/h1-4,6,12,20H,5,19H2,(H,21,22)/t12-/m0/s1
    Synonyms: triiodothyronine | UNII-06LU7C9H1V | REGID_for_CID_5920 | Thyrolar-0.25 | Triiodothyronine, l- | 06LU7C9H1V | DTXSID8...
per page