Peptide Synthesis

Shop By
View as List Grid

4 Items

Set Descending Direction
  1. L-Alanine, sodium-coupled neutral amino acid transporter 1;sodium-coupled neutral amino acid transporter 2;sodium-coupled neutral amino acid transporter 4
    Cas#: 56-41-7        Compound CID:  5950
    Formula:  C3H7NO2        Molecular Weight: 89.09
    IUPAC Name: (2S)-2-aminopropanoic acid
    SMILES: CC(C(=O)O)N
    InChIKey: QNAYBMKLOCPYGJ-REOHCLBHSA-N
    InChI: InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1
    Synonyms: (S)-Alanine | L-alpha-Aminopropionic acid | alpha-Alanine | 2-Aminopropionic acid | H-Ala-OH | (L)-Alanine | L-2-Amin...
  2. 4-Chloro-DL-phenylalanine, Inhibitor of L-Phenylalanine hydroxylase ;Inhibitor of L-Tryptophan hydroxylase 1;Inhibitor of L-Tryptophan hydroxylase 2
    Cas#: 7424-00-2        Compound CID:  4652
    Formula:  C9H10ClNO2        Molecular Weight: 199.63
    IUPAC Name: 2-amino-3-(4-chlorophenyl)propanoic acid
    SMILES: C1=CC(=CC=C1CC(C(=O)O)N)Cl
    InChIKey: NIGWMJHCCYYCSF-UHFFFAOYSA-N
    InChI: InChI=1S/C9H10ClNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)
    Synonyms: 2-amino-3-(4-chlorophenyl)propanoic acid | Fenchlonine | C-Pal | DL-3-(p-Chlorophenyl)alanine | DL-p-Chlorophenylalan...
  3. β-Alanine
    Cas#: 107-95-9        Compound CID:  239
    Formula:  C3H7NO2        Molecular Weight: 89.09
    IUPAC Name: 3-aminopropanoic acid
    SMILES: C(CN)C(=O)O
    InChIKey: UCMIRNVEIXFBKS-UHFFFAOYSA-N
    InChI: InChI=1S/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6)
    Synonyms: ALANINE, BETA | Alanine, beta- | BETA ALANINE [USP-RS] | EC 203-536-5 | HY-N0230 | omega-Aminopropionate | Q310919 | ...
  4. γ-Aminobutyric acid, Agonist of GABA B1;Agonist of GABA B receptor
    Cas#: 56-12-2       
    Formula:  C4H9NO2        Molecular Weight: 103.12
    IUPAC Name: 4-aminobutanoic acid
    SMILES: C(CC(=O)O)CN
    InChIKey: BTCSSZJGUNDROE-UHFFFAOYSA-N
    InChI: InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7)
    Synonyms: GABA | 3-Carboxypropylamine | 4-amino-n-butyric acid | butanoic acid, 4-amino- | EPA Pesticide Chemical Code 030802 |...
per page