Peptide Synthesis

Shop By
View as List Grid

3 Items

Set Descending Direction
  1. D-Aspartic acid, Excitatory amino acid transporter 1;Excitatory amino acid transporter 2;Excitatory amino acid transporter 3;Excitatory amino acid transporter 4;Excitatory amino acid transporter 5;Agonist of GluN1;Agonist of GluN2A;Agonist of GluN2B;Agonist of GluN2C;Agon
    Cas#: 1783-96-6        Compound CID:  83887
    Formula:  C4H7NO4        Molecular Weight: 133.10
    IUPAC Name: (2R)-2-aminobutanedioic acid
    SMILES: C(C(C(=O)O)N)C(=O)O
    InChIKey: CKLJMWTZIZZHCS-UWTATZPHSA-N
    InChI: InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m1/s1
    Synonyms: 2,2'-methanediylbis(1H-benzimidazole) | 6-benzyloxy-1H-indole | C4H7NO4 | delta-aspartate | SR-01000597731 | C00402 |...
  2. L-Aspartic acid, Agonist of GluN1;Agonist of GluN2A;Agonist of GluN2B;Agonist of GluN2C;Agonist of GluN2D
    Cas#: 56-84-8        Compound CID:  5960
    Formula:  C4H7NO4        Molecular Weight: 133.10
    IUPAC Name: (2S)-2-aminobutanedioic acid
    SMILES: N[C@@H](CC(O)=O)C(O)=O
    InChIKey: CKLJMWTZIZZHCS-REOHCLBHSA-N
    InChI: InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1
    Synonyms: Acide aspartique | Asparaginsaeure | Aspartic acid [USAN:USP:INN] | Aspatofort | EINECS 200-291-6 | [3h]-l-asp | ASPA...
  3. 3,3',5-Triiodo-L-thyronine, Thyroid hormone receptor agonist
    Cas#: 6893-02-3        Compound CID:  5920
    Formula:  C15H12I3NO4        Molecular Weight: 650.98
    IUPAC Name: (2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoic acid
    SMILES: C1=CC(=C(C=C1OC2=C(C=C(C=C2I)CC(C(=O)O)N)I)I)O
    InChIKey: AUYYCJSJGJYCDS-LBPRGKRZSA-N
    InChI: InChI=1S/C15H12I3NO4/c16-9-6-8(1-2-13(9)20)23-14-10(17)3-7(4-11(14)18)5-12(19)15(21)22/h1-4,6,12,20H,5,19H2,(H,21,22)/t12-/m0/s1
    Synonyms: triiodothyronine | UNII-06LU7C9H1V | REGID_for_CID_5920 | Thyrolar-0.25 | Triiodothyronine, l- | 06LU7C9H1V | DTXSID8...
per page