Peptide Synthesis

Shop By
View as List Grid

6 Items

Set Descending Direction
  1. L-Alanine, sodium-coupled neutral amino acid transporter 1;sodium-coupled neutral amino acid transporter 2;sodium-coupled neutral amino acid transporter 4
    Cas#: 56-41-7        Compound CID:  5950
    Formula:  C3H7NO2        Molecular Weight: 89.09
    IUPAC Name: (2S)-2-aminopropanoic acid
    SMILES: CC(C(=O)O)N
    InChIKey: QNAYBMKLOCPYGJ-REOHCLBHSA-N
    InChI: InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1
    Synonyms: (S)-Alanine | L-alpha-Aminopropionic acid | alpha-Alanine | 2-Aminopropionic acid | H-Ala-OH | (L)-Alanine | L-2-Amin...
  2. L-Phenylalanine, Agonist of GPR139
    Cas#: 63-91-2        Compound CID:  6140
    Formula:  C9H11NO2        Molecular Weight: 165.2
    IUPAC Name: (2S)-2-amino-3-phenylpropanoic acid
    SMILES: C1=CC=C(C=C1)CC(C(=O)O)N
    InChIKey: COLNVLDHVKWLRT-QMMMGPOBSA-N
    InChI: InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1
    Synonyms: NCIStruc2_000248 | PHENYLALANINE [VANDF] | Phenylalanine, L- | (-)-phenylalanine | Alanine, phenyl-, L- | beta-Phenyl...
  3. D-Aspartic acid, Excitatory amino acid transporter 1;Excitatory amino acid transporter 2;Excitatory amino acid transporter 3;Excitatory amino acid transporter 4;Excitatory amino acid transporter 5;Agonist of GluN1;Agonist of GluN2A;Agonist of GluN2B;Agonist of GluN2C;Agon
    Cas#: 1783-96-6        Compound CID:  83887
    Formula:  C4H7NO4        Molecular Weight: 133.10
    IUPAC Name: (2R)-2-aminobutanedioic acid
    SMILES: C(C(C(=O)O)N)C(=O)O
    InChIKey: CKLJMWTZIZZHCS-UWTATZPHSA-N
    InChI: InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m1/s1
    Synonyms: 2,2'-methanediylbis(1H-benzimidazole) | 6-benzyloxy-1H-indole | C4H7NO4 | delta-aspartate | SR-01000597731 | C00402 |...
  4. 5-Hydroxy-L-tryptophan, Inhibitor of Proton-coupled Amino acid Transporter 1;Inhibitor of Proton-coupled Amino acid Transporter 2
    Cas#: 4350-09-8        Compound CID:  439280
    Formula:  C11H12N2O3        Molecular Weight: 220.22
    IUPAC Name: (2S)-2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid
    SMILES: C1=CC2=C(C=C1O)C(=CN2)CC(C(=O)O)N
    InChIKey: LDCYZAJDBXYCGN-VIFPVBQESA-N
    InChI: InChI=1S/C11H12N2O3/c12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10/h1-2,4-5,9,13-14H,3,12H2,(H,15,16)/t9-/m0/s1
    Synonyms: (2S)-2-amino-3-(5-hydroxyindol-3-yl)propanoic acid | bmse000457 | NCGC00091062-03 | NCGC00091062-04 | Oxitriptanum [I...
  5. L-Aspartic acid, Agonist of GluN1;Agonist of GluN2A;Agonist of GluN2B;Agonist of GluN2C;Agonist of GluN2D
    Cas#: 56-84-8        Compound CID:  5960
    Formula:  C4H7NO4        Molecular Weight: 133.10
    IUPAC Name: (2S)-2-aminobutanedioic acid
    SMILES: N[C@@H](CC(O)=O)C(O)=O
    InChIKey: CKLJMWTZIZZHCS-REOHCLBHSA-N
    InChI: InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1
    Synonyms: Acide aspartique | Asparaginsaeure | Aspartic acid [USAN:USP:INN] | Aspatofort | EINECS 200-291-6 | [3h]-l-asp | ASPA...
  6. L-Tryptophan
    Cas#: 73-22-3        Compound CID:  6305
    Formula:  C11H12N2O2        Molecular Weight: 204.23
    IUPAC Name: (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid
    SMILES: C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)N
    InChIKey: QIVBCDIJIAJPQS-VIFPVBQESA-N
    InChI: InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1
    Synonyms: TRP | TRYPTOPHAN [USP MONOGRAPH] | Tryptophanum | Tryptan | 1H-Indole-3-alanine | L-Trp | TRYPTOPHAN [INCI] | (S)-2-A...
per page