Peptide Synthesis

Shop By
View as List Grid

3 Items

Set Descending Direction
  1. L-Alanine, sodium-coupled neutral amino acid transporter 1;sodium-coupled neutral amino acid transporter 2;sodium-coupled neutral amino acid transporter 4
    Cas#: 56-41-7        Compound CID:  5950
    Formula:  C3H7NO2        Molecular Weight: 89.09
    IUPAC Name: (2S)-2-aminopropanoic acid
    SMILES: CC(C(=O)O)N
    InChIKey: QNAYBMKLOCPYGJ-REOHCLBHSA-N
    InChI: InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1
    Synonyms: (S)-Alanine | L-alpha-Aminopropionic acid | alpha-Alanine | 2-Aminopropionic acid | H-Ala-OH | (L)-Alanine | L-2-Amin...
  2. L-O-Phosphoserine(L-SOP), Agonist of mGlu 4 receptor;Agonist of mGlu 6 receptor;Agonist of mGlu 7 receptor;Agonist of mGlu 8 receptor
    Cas#: 407-41-0        Compound CID:  68841
    Formula:  C3H8NO6P        Molecular Weight: 185.07
    IUPAC Name: (2S)-2-amino-3-phosphonooxypropanoic acid
    SMILES: C(C(C(=O)O)N)OP(=O)(O)O
    InChIKey: BZQFBWGGLXLEPQ-REOHCLBHSA-N
    InChI: InChI=1S/C3H8NO6P/c4-2(3(5)6)1-10-11(7,8)9/h2H,1,4H2,(H,5,6)(H2,7,8,9)/t2-/m0/s1
    Synonyms: L-SOP | CAS-407-41-0 | H-Ser(PO3H2)-OH | Phosphatidalserine | A873241 | CCG-204968 | NCGC00261571-01 | s5137 | (2S)-2...
  3. 4-Chloro-DL-phenylalanine, Inhibitor of L-Phenylalanine hydroxylase ;Inhibitor of L-Tryptophan hydroxylase 1;Inhibitor of L-Tryptophan hydroxylase 2
    Cas#: 7424-00-2        Compound CID:  4652
    Formula:  C9H10ClNO2        Molecular Weight: 199.63
    IUPAC Name: 2-amino-3-(4-chlorophenyl)propanoic acid
    SMILES: C1=CC(=CC=C1CC(C(=O)O)N)Cl
    InChIKey: NIGWMJHCCYYCSF-UHFFFAOYSA-N
    InChI: InChI=1S/C9H10ClNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)
    Synonyms: 2-amino-3-(4-chlorophenyl)propanoic acid | Fenchlonine | C-Pal | DL-3-(p-Chlorophenyl)alanine | DL-p-Chlorophenylalan...
per page