Peptide Synthesis

Shop By
View as List Grid

3 Items

Set Descending Direction
  1. L-Alanine, sodium-coupled neutral amino acid transporter 1;sodium-coupled neutral amino acid transporter 2;sodium-coupled neutral amino acid transporter 4
    Cas#: 56-41-7        Compound CID:  5950
    Formula:  C3H7NO2        Molecular Weight: 89.09
    IUPAC Name: (2S)-2-aminopropanoic acid
    SMILES: CC(C(=O)O)N
    InChIKey: QNAYBMKLOCPYGJ-REOHCLBHSA-N
    InChI: InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1
    Synonyms: (S)-Alanine | L-alpha-Aminopropionic acid | alpha-Alanine | 2-Aminopropionic acid | H-Ala-OH | (L)-Alanine | L-2-Amin...
  2. L-Glutamine, Sodium-coupled neutral amino acid transporter 3
    Cas#: 56-85-9        Compound CID:  5961
    Formula:  C5H10N2O3        Molecular Weight: 146.15
    IUPAC Name: (2S)-2,5-diamino-5-oxopentanoic acid
    SMILES: C(CC(=O)N)C(C(=O)O)N
    InChIKey: ZDXPYRJPNDTMRX-VKHMYHEASA-N
    InChI: InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1
    Synonyms: BRN 1723797 | EINECS 200-292-1 | Glutamine (L-Glutamine) | Levoglutamida | NSC 27421 | Glutamic acid-5-amide | L-Glut...
  3. D-Aspartic acid, Excitatory amino acid transporter 1;Excitatory amino acid transporter 2;Excitatory amino acid transporter 3;Excitatory amino acid transporter 4;Excitatory amino acid transporter 5;Agonist of GluN1;Agonist of GluN2A;Agonist of GluN2B;Agonist of GluN2C;Agon
    Cas#: 1783-96-6        Compound CID:  83887
    Formula:  C4H7NO4        Molecular Weight: 133.10
    IUPAC Name: (2R)-2-aminobutanedioic acid
    SMILES: C(C(C(=O)O)N)C(=O)O
    InChIKey: CKLJMWTZIZZHCS-UWTATZPHSA-N
    InChI: InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m1/s1
    Synonyms: 2,2'-methanediylbis(1H-benzimidazole) | 6-benzyloxy-1H-indole | C4H7NO4 | delta-aspartate | SR-01000597731 | C00402 |...
per page