Peptide Synthesis

Shop By
View as List Grid

4 Items

Set Descending Direction
  1. D-Aspartic acid, Excitatory amino acid transporter 1;Excitatory amino acid transporter 2;Excitatory amino acid transporter 3;Excitatory amino acid transporter 4;Excitatory amino acid transporter 5;Agonist of GluN1;Agonist of GluN2A;Agonist of GluN2B;Agonist of GluN2C;Agon
    Cas#: 1783-96-6        Compound CID:  83887
    Formula:  C4H7NO4        Molecular Weight: 133.10
    IUPAC Name: (2R)-2-aminobutanedioic acid
    SMILES: C(C(C(=O)O)N)C(=O)O
    InChIKey: CKLJMWTZIZZHCS-UWTATZPHSA-N
    InChI: InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m1/s1
    Synonyms: 2,2'-methanediylbis(1H-benzimidazole) | 6-benzyloxy-1H-indole | C4H7NO4 | delta-aspartate | SR-01000597731 | C00402 |...
  2. L-Aspartic acid, Agonist of GluN1;Agonist of GluN2A;Agonist of GluN2B;Agonist of GluN2C;Agonist of GluN2D
    Cas#: 56-84-8        Compound CID:  5960
    Formula:  C4H7NO4        Molecular Weight: 133.10
    IUPAC Name: (2S)-2-aminobutanedioic acid
    SMILES: N[C@@H](CC(O)=O)C(O)=O
    InChIKey: CKLJMWTZIZZHCS-REOHCLBHSA-N
    InChI: InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1
    Synonyms: Acide aspartique | Asparaginsaeure | Aspartic acid [USAN:USP:INN] | Aspatofort | EINECS 200-291-6 | [3h]-l-asp | ASPA...
  3. L-Histidine, Peptide transporter 3;Peptide transporter 4;Sodium-coupled neutral amino acid transporter 5
    Cas#: 71-00-1        Compound CID:  6274
    Formula:  C6H9N3O2        Molecular Weight: 155.15
    IUPAC Name: (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid
    SMILES: C1=C(NC=N1)CC(C(=O)O)N
    InChIKey: HNDVDQJCIGZPNO-YFKPBYRVSA-N
    InChI: InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m0/s1
    Synonyms: (S)-2-Amino-3-(4-imidazolyl)propionic acid | NSC 137773 | H-His-OH
  4. 3-Iodo-L-tyrosine
      Grade & Purity: 
    • ≥98%
    Cas#: 70-78-0        Compound CID:  439744
    Formula:  C9H10INO3        Molecular Weight: 307.09
    IUPAC Name: (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid
    SMILES: C1=CC(=C(C=C1CC(C(=O)O)N)I)O
    InChIKey: UQTZMGFTRHFAAM-ZETCQYMHSA-N
    InChI: InChI=1S/C9H10INO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14)/t7-/m0/s1
    Synonyms: (2S)-2-azanyl-3-(3-iodanyl-4-oxidanyl-phenyl)propanoic acid | 3-IODOTYROSINE | IODOTYROSINE | L-Tyrosine-3-iodo | 3-I...
per page