| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| N159613-5g | 5g | 9 | $145.90 | |
| N159613-25g | 25g | 6 | $502.90 |
| Specifications & Purity | ≥98%(HPLC)(T) |
|---|---|
| Shipped In | Normal |
| Pubchem Sid | 504760546 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504760546 |
| IUPAC Name | (2R)-2-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)acetic acid |
| INCHI | InChI=1S/C16H15NO5/c18-13-8-6-12(7-9-13)14(15(19)20)17-16(21)22-10-11-4-2-1-3-5-11/h1-9,14,18H,10H2,(H,17,21)(H,19,20)/t14-/m1/s1 |
| InChi Key | CGDQNVNWDDEJPY-CQSZACIVSA-N |
| Canonical SMILES | C1=CC=C(C=C1)COC(=O)NC(C2=CC=C(C=C2)O)C(=O)O |
| Isomeric SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](C2=CC=C(C=C2)O)C(=O)O |
| PubChem CID | 1514128 |
| Molecular Weight | 301.3 |
| Reaxy-Rn | 3561093 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
 K2327246 | Certificate of Analysis | Nov 09, 2023 | N159613 |
| K2327248 | Certificate of Analysis | Nov 09, 2023 | N159613 |
| K2327245 | Certificate of Analysis | Nov 09, 2023 | N159613 |
| K2327247 | Certificate of Analysis | Nov 09, 2023 | N159613 |
| Solubility | Soluble in Methanol |
|---|---|
| Molecular Weight | 301.290 g/mol |
| XLogP3 | 2.400 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 6 |
| Exact Mass | 301.095 Da |
| Monoisotopic Mass | 301.095 Da |
| Topological Polar Surface Area | 95.900 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 373.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| Reaxy-Rn | 3561093 |
|---|
Starting at $93.90
Starting at $14.90
Starting at $25.90
Starting at $9.90
